C20H32N2O2S — CID 20630451
N-(4-butylphenyl)-4-(propan-2-ylsulfinylamino)cyclohexane-1-carboxamide (PubChem CID 20630451) has the molecular formula C20H32N2O2S and a molecular weight of 364.56 g/mol. Its IUPAC name is N-(4-butylphenyl)-4-(propan-2-ylsulfinylamino)cyclohexane-1-carboxamide.
| Compound Name | N-(4-butylphenyl)-4-(propan-2-ylsulfinylamino)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 20630451 |
| Molecular Formula | C20H32N2O2S |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | N-(4-butylphenyl)-4-(propan-2-ylsulfinylamino)cyclohexane-1-carboxamide |
| SMILES | CCCCc1ccc(NC(=O)C2CCC(NS(=O)C(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H32N2O2S/c1-4-5-6-16-7-11-18(12-8-16)21-20(23)17-9-13-19(14-10-17)22-25(24)15(2)3/h7-8,11-12,15,17,19,22H,4-6,9-10,13-14H2,1-3H3,(H,21,23) |
| InChIKey | QHAYUMOSLOFZPH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |