C22H34BrNO — CID 82259475
N-[4-(2-bromo-3-methylbutyl)phenyl]-4-butylcyclohexane-1-carboxamide (PubChem CID 82259475) has the molecular formula C22H34BrNO and a molecular weight of 408.42 g/mol. Its IUPAC name is N-[4-(2-bromo-3-methylbutyl)phenyl]-4-butylcyclohexane-1-carboxamide.
| Compound Name | N-[4-(2-bromo-3-methylbutyl)phenyl]-4-butylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 82259475 |
| Molecular Formula | C22H34BrNO |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-[4-(2-bromo-3-methylbutyl)phenyl]-4-butylcyclohexane-1-carboxamide |
| SMILES | CCCCC1CCC(C(=O)Nc2ccc(CC(Br)C(C)C)cc2)CC1 |
| InChI | InChI=1S/C22H34BrNO/c1-4-5-6-17-7-11-19(12-8-17)22(25)24-20-13-9-18(10-14-20)15-21(23)16(2)3/h9-10,13-14,16-17,19,21H,4-8,11-12,15H2,1-3H3,(H,24,25) |
| InChIKey | FYJFIWLWSIXIOV-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|