C20H28ClNO2 — CID 82259069
4-butyl-N-[4-(2-chloropropanoyl)phenyl]cyclohexane-1-carboxamide (PubChem CID 82259069) has the molecular formula C20H28ClNO2 and a molecular weight of 349.90 g/mol. Its IUPAC name is 4-butyl-N-[4-(2-chloropropanoyl)phenyl]cyclohexane-1-carboxamide.
| Compound Name | 4-butyl-N-[4-(2-chloropropanoyl)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 82259069 |
| Molecular Formula | C20H28ClNO2 |
| Molecular Weight | 349.90 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 4-butyl-N-[4-(2-chloropropanoyl)phenyl]cyclohexane-1-carboxamide |
| SMILES | CCCCC1CCC(C(=O)Nc2ccc(C(=O)C(C)Cl)cc2)CC1 |
| InChI | InChI=1S/C20H28ClNO2/c1-3-4-5-15-6-8-17(9-7-15)20(24)22-18-12-10-16(11-13-18)19(23)14(2)21/h10-15,17H,3-9H2,1-2H3,(H,22,24) |
| InChIKey | IEWWRLAPVYWKCQ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.90 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|