C24H38N2O — CID 108737739
4-butyl-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]cyclohexane-1-carboxamide (PubChem CID 108737739) has the molecular formula C24H38N2O and a molecular weight of 370.58 g/mol. Its IUPAC name is 4-butyl-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]cyclohexane-1-carboxamide.
| Compound Name | 4-butyl-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 108737739 |
| Molecular Formula | C24H38N2O |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.30 |
| IUPAC Name | 4-butyl-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]cyclohexane-1-carboxamide |
| SMILES | CCCCC1CCC(C(=O)Nc2ccc(CN3CCC(C)CC3)cc2)CC1 |
| InChI | InChI=1S/C24H38N2O/c1-3-4-5-20-6-10-22(11-7-20)24(27)25-23-12-8-21(9-13-23)18-26-16-14-19(2)15-17-26/h8-9,12-13,19-20,22H,3-7,10-11,14-18H2,1-2H3,(H,25,27) |
| InChIKey | TUFQWZUOLZZPPS-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |