C16H20NO3- — CID 6991461
4-[(4-ethylcyclohexanecarbonyl)amino]benzoate (PubChem CID 6991461) has the molecular formula C16H20NO3- and a molecular weight of 274.34 g/mol. Its IUPAC name is 4-[(4-ethylcyclohexanecarbonyl)amino]benzoate.
| Compound Name | 4-[(4-ethylcyclohexanecarbonyl)amino]benzoate |
|---|---|
| PubChem CID | 6991461 |
| Molecular Formula | C16H20NO3- |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 4-[(4-ethylcyclohexanecarbonyl)amino]benzoate |
| SMILES | CCC1CCC(C(=O)Nc2ccc(C(=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C16H21NO3/c1-2-11-3-5-12(6-4-11)15(18)17-14-9-7-13(8-10-14)16(19)20/h7-12H,2-6H2,1H3,(H,17,18)(H,19,20)/p-1 |
| InChIKey | XNGKLZQCWQDSON-UHFFFAOYSA-M |
| XLogP | 2.20 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |