C20H28N2O3 — CID 109149468
1-N-(4-acetylphenyl)-4-N,4-N-diethylcyclohexane-1,4-dicarboxamide (PubChem CID 109149468) has the molecular formula C20H28N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is 1-N-(4-acetylphenyl)-4-N,4-N-diethylcyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N-(4-acetylphenyl)-4-N,4-N-diethylcyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109149468 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 1-N-(4-acetylphenyl)-4-N,4-N-diethylcyclohexane-1,4-dicarboxamide |
| SMILES | CCN(CC)C(=O)C1CCC(C(=O)Nc2ccc(C(C)=O)cc2)CC1 |
| InChI | InChI=1S/C20H28N2O3/c1-4-22(5-2)20(25)17-8-6-16(7-9-17)19(24)21-18-12-10-15(11-13-18)14(3)23/h10-13,16-17H,4-9H2,1-3H3,(H,21,24) |
| InChIKey | AMIVTCOBIQTNKL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |