C18H24Cl2N2O2 — CID 109149500
1-N-(3,5-dichlorophenyl)-4-N,4-N-diethylcyclohexane-1,4-dicarboxamide (PubChem CID 109149500) has the molecular formula C18H24Cl2N2O2 and a molecular weight of 371.31 g/mol. Its IUPAC name is 1-N-(3,5-dichlorophenyl)-4-N,4-N-diethylcyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N-(3,5-dichlorophenyl)-4-N,4-N-diethylcyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109149500 |
| Molecular Formula | C18H24Cl2N2O2 |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 1-N-(3,5-dichlorophenyl)-4-N,4-N-diethylcyclohexane-1,4-dicarboxamide |
| SMILES | CCN(CC)C(=O)C1CCC(C(=O)Nc2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H24Cl2N2O2/c1-3-22(4-2)18(24)13-7-5-12(6-8-13)17(23)21-16-10-14(19)9-15(20)11-16/h9-13H,3-8H2,1-2H3,(H,21,23) |
| InChIKey | KCEGFHCHIKMJAL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |