C17H23Cl2N3O2 — CID 56923410
4-N-(3,5-dichlorophenyl)-1-N,1-N-diethylpiperidine-1,4-dicarboxamide (PubChem CID 56923410) has the molecular formula C17H23Cl2N3O2 and a molecular weight of 372.30 g/mol. Its IUPAC name is 4-N-(3,5-dichlorophenyl)-1-N,1-N-diethylpiperidine-1,4-dicarboxamide.
| Compound Name | 4-N-(3,5-dichlorophenyl)-1-N,1-N-diethylpiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 56923410 |
| Molecular Formula | C17H23Cl2N3O2 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 4-N-(3,5-dichlorophenyl)-1-N,1-N-diethylpiperidine-1,4-dicarboxamide |
| SMILES | CCN(CC)C(=O)N1CCC(C(=O)Nc2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H23Cl2N3O2/c1-3-21(4-2)17(24)22-7-5-12(6-8-22)16(23)20-15-10-13(18)9-14(19)11-15/h9-12H,3-8H2,1-2H3,(H,20,23) |
| InChIKey | OGOWHYRIQNYQPB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |