C21H24N2O2 — CID 112988197
N-[4-(4-acetylanilino)phenyl]cyclohexanecarboxamide (PubChem CID 112988197) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[4-(4-acetylanilino)phenyl]cyclohexanecarboxamide.
| Compound Name | N-[4-(4-acetylanilino)phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 112988197 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N-[4-(4-acetylanilino)phenyl]cyclohexanecarboxamide |
| SMILES | CC(=O)c1ccc(Nc2ccc(NC(=O)C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C21H24N2O2/c1-15(24)16-7-9-18(10-8-16)22-19-11-13-20(14-12-19)23-21(25)17-5-3-2-4-6-17/h7-14,17,22H,2-6H2,1H3,(H,23,25) |
| InChIKey | VEDATTOBILVLLC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |