C21H29N3O2S — CID 136652792
2-[hydroxy-(4-octylanilino)methylidene]-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one (PubChem CID 136652792) has the molecular formula C21H29N3O2S and a molecular weight of 387.55 g/mol. Its IUPAC name is 2-[hydroxy-(4-octylanilino)methylidene]-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one.
| Compound Name | 2-[hydroxy-(4-octylanilino)methylidene]-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one |
|---|---|
| PubChem CID | 136652792 |
| Molecular Formula | C21H29N3O2S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 2-[hydroxy-(4-octylanilino)methylidene]-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one |
| SMILES | CCCCCCCCc1ccc(NC(O)=c2sc3n(c2=O)CCCN=3)cc1 |
| InChI | InChI=1S/C21H29N3O2S/c1-2-3-4-5-6-7-9-16-10-12-17(13-11-16)23-19(25)18-20(26)24-15-8-14-22-21(24)27-18/h10-13,23,25H,2-9,14-15H2,1H3 |
| InChIKey | DKVNALLWVKUWKR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|