C21H26N2O3S — CID 55432816
4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(4-pentylphenyl)benzamide (PubChem CID 55432816) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(4-pentylphenyl)benzamide.
| Compound Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(4-pentylphenyl)benzamide |
|---|---|
| PubChem CID | 55432816 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(4-pentylphenyl)benzamide |
| SMILES | CCCCCc1ccc(NC(=O)c2ccc(N3CCCS3(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C21H26N2O3S/c1-2-3-4-6-17-7-11-19(12-8-17)22-21(24)18-9-13-20(14-10-18)23-15-5-16-27(23,25)26/h7-14H,2-6,15-16H2,1H3,(H,22,24) |
| InChIKey | HQHSPLBDNBTAKD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|