C21H25N3O2 — CID 134055766
4-(2-oxoimidazolidin-1-yl)-N-(4-pentylphenyl)benzamide (PubChem CID 134055766) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-(2-oxoimidazolidin-1-yl)-N-(4-pentylphenyl)benzamide.
| Compound Name | 4-(2-oxoimidazolidin-1-yl)-N-(4-pentylphenyl)benzamide |
|---|---|
| PubChem CID | 134055766 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 4-(2-oxoimidazolidin-1-yl)-N-(4-pentylphenyl)benzamide |
| SMILES | CCCCCc1ccc(NC(=O)c2ccc(N3CCNC3=O)cc2)cc1 |
| InChI | InChI=1S/C21H25N3O2/c1-2-3-4-5-16-6-10-18(11-7-16)23-20(25)17-8-12-19(13-9-17)24-15-14-22-21(24)26/h6-13H,2-5,14-15H2,1H3,(H,22,26)(H,23,25) |
| InChIKey | RZGVRHMPNJQULD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|