C12H16N2O3S — CID 51246187
4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-ethylbenzamide (PubChem CID 51246187) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-ethylbenzamide.
| Compound Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-ethylbenzamide |
|---|---|
| PubChem CID | 51246187 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccc(N2CCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C12H16N2O3S/c1-2-13-12(15)10-4-6-11(7-5-10)14-8-3-9-18(14,16)17/h4-7H,2-3,8-9H2,1H3,(H,13,15) |
| InChIKey | LTZNCZNBGSWTNT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |