C16H25N3O5S2 — CID 55693771
4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-[3-[ethylsulfonyl(methyl)amino]propyl]benzamide (PubChem CID 55693771) has the molecular formula C16H25N3O5S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-[3-[ethylsulfonyl(methyl)amino]propyl]benzamide.
| Compound Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-[3-[ethylsulfonyl(methyl)amino]propyl]benzamide |
|---|---|
| PubChem CID | 55693771 |
| Molecular Formula | C16H25N3O5S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-[3-[ethylsulfonyl(methyl)amino]propyl]benzamide |
| SMILES | CCS(=O)(=O)N(C)CCCNC(=O)c1ccc(N2CCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C16H25N3O5S2/c1-3-25(21,22)18(2)11-4-10-17-16(20)14-6-8-15(9-7-14)19-12-5-13-26(19,23)24/h6-9H,3-5,10-13H2,1-2H3,(H,17,20) |
| InChIKey | JBPWFZRVHLOAPM-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|