C20H25N3O5S — CID 56545981
4-[4-[3-[ethylsulfonyl(methyl)amino]propylcarbamoyl]phenoxy]benzamide (PubChem CID 56545981) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is 4-[4-[3-[ethylsulfonyl(methyl)amino]propylcarbamoyl]phenoxy]benzamide.
| Compound Name | 4-[4-[3-[ethylsulfonyl(methyl)amino]propylcarbamoyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 56545981 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 4-[4-[3-[ethylsulfonyl(methyl)amino]propylcarbamoyl]phenoxy]benzamide |
| SMILES | CCS(=O)(=O)N(C)CCCNC(=O)c1ccc(Oc2ccc(C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C20H25N3O5S/c1-3-29(26,27)23(2)14-4-13-22-20(25)16-7-11-18(12-8-16)28-17-9-5-15(6-10-17)19(21)24/h5-12H,3-4,13-14H2,1-2H3,(H2,21,24)(H,22,25) |
| InChIKey | DOOCZXGSOKVXSC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|