C17H24N4O3S — CID 55721630
N-[3-[ethylsulfonyl(methyl)amino]propyl]-4-(imidazol-1-ylmethyl)benzamide (PubChem CID 55721630) has the molecular formula C17H24N4O3S and a molecular weight of 364.47 g/mol. Its IUPAC name is N-[3-[ethylsulfonyl(methyl)amino]propyl]-4-(imidazol-1-ylmethyl)benzamide.
| Compound Name | N-[3-[ethylsulfonyl(methyl)amino]propyl]-4-(imidazol-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55721630 |
| Molecular Formula | C17H24N4O3S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-[3-[ethylsulfonyl(methyl)amino]propyl]-4-(imidazol-1-ylmethyl)benzamide |
| SMILES | CCS(=O)(=O)N(C)CCCNC(=O)c1ccc(Cn2ccnc2)cc1 |
| InChI | InChI=1S/C17H24N4O3S/c1-3-25(23,24)20(2)11-4-9-19-17(22)16-7-5-15(6-8-16)13-21-12-10-18-14-21/h5-8,10,12,14H,3-4,9,11,13H2,1-2H3,(H,19,22) |
| InChIKey | ZMRVOZVVCOYJDC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|