C17H23N3OS — CID 43922772
N-(2-tert-butylsulfanylethyl)-4-(imidazol-1-ylmethyl)benzamide (PubChem CID 43922772) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is N-(2-tert-butylsulfanylethyl)-4-(imidazol-1-ylmethyl)benzamide.
| Compound Name | N-(2-tert-butylsulfanylethyl)-4-(imidazol-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 43922772 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | N-(2-tert-butylsulfanylethyl)-4-(imidazol-1-ylmethyl)benzamide |
| SMILES | CC(C)(C)SCCNC(=O)c1ccc(Cn2ccnc2)cc1 |
| InChI | InChI=1S/C17H23N3OS/c1-17(2,3)22-11-9-19-16(21)15-6-4-14(5-7-15)12-20-10-8-18-13-20/h4-8,10,13H,9,11-12H2,1-3H3,(H,19,21) |
| InChIKey | SDGVTLQOLSRWQH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|