C18H20N4O4S — CID 55690257
N-[2-[[4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoyl]amino]ethyl]pyridine-3-carboxamide (PubChem CID 55690257) has the molecular formula C18H20N4O4S and a molecular weight of 388.45 g/mol. Its IUPAC name is N-[2-[[4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoyl]amino]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[[4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoyl]amino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55690257 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-[2-[[4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoyl]amino]ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCNC(=O)c1cccnc1)c1ccc(N2CCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C18H20N4O4S/c23-17(20-9-10-21-18(24)15-3-1-8-19-13-15)14-4-6-16(7-5-14)22-11-2-12-27(22,25)26/h1,3-8,13H,2,9-12H2,(H,20,23)(H,21,24) |
| InChIKey | RMZDQCBQNMVTOZ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|