C6H7N3O4S2 — CID 175149624
2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]-2-hydroxyacetic acid (PubChem CID 175149624) has the molecular formula C6H7N3O4S2 and a molecular weight of 249.27 g/mol. Its IUPAC name is 2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]-2-hydroxyacetic acid.
| Compound Name | 2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 175149624 |
| Molecular Formula | C6H7N3O4S2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 248.99 |
| IUPAC Name | 2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]-2-hydroxyacetic acid |
| SMILES | CC(=O)Nc1nnc(SC(O)C(=O)O)s1 |
| InChI | InChI=1S/C6H7N3O4S2/c1-2(10)7-5-8-9-6(15-5)14-4(13)3(11)12/h4,13H,1H3,(H,11,12)(H,7,8,10) |
| InChIKey | RFDFPBOODIIESX-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|