C8H15N4OS2+ — CID 2481040
2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl-dimethylazanium (PubChem CID 2481040) has the molecular formula C8H15N4OS2+ and a molecular weight of 247.37 g/mol. Its IUPAC name is 2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl-dimethylazanium.
| Compound Name | 2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 2481040 |
| Molecular Formula | C8H15N4OS2+ |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl-dimethylazanium |
| SMILES | CC(=O)Nc1nnc(SCC[NH+](C)C)s1 |
| InChI | InChI=1S/C8H14N4OS2/c1-6(13)9-7-10-11-8(15-7)14-5-4-12(2)3/h4-5H2,1-3H3,(H,9,10,13)/p+1 |
| InChIKey | YESCEJFTPCKVHB-UHFFFAOYSA-O |
| XLogP | -0.27 |
| TPSA | 59.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|