C11H10BrN3OS2 — CID 2191850
N-[5-[(2-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 2191850) has the molecular formula C11H10BrN3OS2 and a molecular weight of 344.26 g/mol. Its IUPAC name is N-[5-[(2-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[(2-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 2191850 |
| Molecular Formula | C11H10BrN3OS2 |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 342.94 |
| IUPAC Name | N-[5-[(2-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nnc(SCc2ccccc2Br)s1 |
| InChI | InChI=1S/C11H10BrN3OS2/c1-7(16)13-10-14-15-11(18-10)17-6-8-4-2-3-5-9(8)12/h2-5H,6H2,1H3,(H,13,14,16) |
| InChIKey | VAWBDUAPIKLPOG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|