C13H20N4O2S2 — CID 71933169
2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(cyclohexylmethyl)acetamide (PubChem CID 71933169) has the molecular formula C13H20N4O2S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(cyclohexylmethyl)acetamide.
| Compound Name | 2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(cyclohexylmethyl)acetamide |
|---|---|
| PubChem CID | 71933169 |
| Molecular Formula | C13H20N4O2S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(cyclohexylmethyl)acetamide |
| SMILES | CC(=O)Nc1nnc(SCC(=O)NCC2CCCCC2)s1 |
| InChI | InChI=1S/C13H20N4O2S2/c1-9(18)15-12-16-17-13(21-12)20-8-11(19)14-7-10-5-3-2-4-6-10/h10H,2-8H2,1H3,(H,14,19)(H,15,16,18) |
| InChIKey | SIAGJIGMCSYXJQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|