C13H20N4O3S2 — CID 1470452
N-[5-[2-(cyclohexylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methoxyacetamide (PubChem CID 1470452) has the molecular formula C13H20N4O3S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-[5-[2-(cyclohexylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methoxyacetamide.
| Compound Name | N-[5-[2-(cyclohexylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 1470452 |
| Molecular Formula | C13H20N4O3S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | N-[5-[2-(cyclohexylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1nnc(SCC(=O)NC2CCCCC2)s1 |
| InChI | InChI=1S/C13H20N4O3S2/c1-20-7-10(18)15-12-16-17-13(22-12)21-8-11(19)14-9-5-3-2-4-6-9/h9H,2-8H2,1H3,(H,14,19)(H,15,16,18) |
| InChIKey | OAQDBLXBQBBSQD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|