C14H22N4O3S2 — CID 1470551
N-[5-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methoxyacetamide (PubChem CID 1470551) has the molecular formula C14H22N4O3S2 and a molecular weight of 358.49 g/mol. Its IUPAC name is N-[5-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methoxyacetamide.
| Compound Name | N-[5-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 1470551 |
| Molecular Formula | C14H22N4O3S2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N-[5-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1nnc(SCC(=O)N2[C@H](C)CCC[C@@H]2C)s1 |
| InChI | InChI=1S/C14H22N4O3S2/c1-9-5-4-6-10(2)18(9)12(20)8-22-14-17-16-13(23-14)15-11(19)7-21-3/h9-10H,4-8H2,1-3H3,(H,15,16,19)/t9-,10+ |
| InChIKey | ADPPSTOCYBRXMH-AOOOYVTPSA-N |
| XLogP | 2.00 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|