C16H26N4O2S2 — CID 7410041
N-[5-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]pentanamide (PubChem CID 7410041) has the molecular formula C16H26N4O2S2 and a molecular weight of 370.54 g/mol. Its IUPAC name is N-[5-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]pentanamide.
| Compound Name | N-[5-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]pentanamide |
|---|---|
| PubChem CID | 7410041 |
| Molecular Formula | C16H26N4O2S2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-[5-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]pentanamide |
| SMILES | CCCCC(=O)Nc1nnc(SCC(=O)N2[C@H](C)CCC[C@@H]2C)s1 |
| InChI | InChI=1S/C16H26N4O2S2/c1-4-5-9-13(21)17-15-18-19-16(24-15)23-10-14(22)20-11(2)7-6-8-12(20)3/h11-12H,4-10H2,1-3H3,(H,17,18,21)/t11-,12+ |
| InChIKey | SSMGBVNXPUGUEF-TXEJJXNPSA-N |
| XLogP | 3.55 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|