C16H18N6O2S3 — CID 20939444
N-[5-[(2-cyclopropyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pentanamide (PubChem CID 20939444) has the molecular formula C16H18N6O2S3 and a molecular weight of 422.56 g/mol. Its IUPAC name is N-[5-[(2-cyclopropyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pentanamide.
| Compound Name | N-[5-[(2-cyclopropyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pentanamide |
|---|---|
| PubChem CID | 20939444 |
| Molecular Formula | C16H18N6O2S3 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | N-[5-[(2-cyclopropyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pentanamide |
| SMILES | CCCCC(=O)Nc1nnc(SCc2cc(=O)n3nc(C4CC4)sc3n2)s1 |
| InChI | InChI=1S/C16H18N6O2S3/c1-2-3-4-11(23)18-14-19-20-16(27-14)25-8-10-7-12(24)22-15(17-10)26-13(21-22)9-5-6-9/h7,9H,2-6,8H2,1H3,(H,18,19,23) |
| InChIKey | INRHKTHTBJZJRW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|