C19H18N6O3S3 — CID 20939366
2-(3,4-dimethylphenoxy)-N-[5-[(2-methyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 20939366) has the molecular formula C19H18N6O3S3 and a molecular weight of 474.59 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)-N-[5-[(2-methyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(3,4-dimethylphenoxy)-N-[5-[(2-methyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 20939366 |
| Molecular Formula | C19H18N6O3S3 |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)-N-[5-[(2-methyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | Cc1nn2c(=O)cc(CSc3nnc(NC(=O)COc4ccc(C)c(C)c4)s3)nc2s1 |
| InChI | InChI=1S/C19H18N6O3S3/c1-10-4-5-14(6-11(10)2)28-8-15(26)21-17-22-23-19(31-17)29-9-13-7-16(27)25-18(20-13)30-12(3)24-25/h4-7H,8-9H2,1-3H3,(H,21,22,26) |
| InChIKey | KFAHBTDROBXBKF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|