C19H20N6OS3 — CID 55737500
7-[[5-(2,6-diethylanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-2-methyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 55737500) has the molecular formula C19H20N6OS3 and a molecular weight of 444.61 g/mol. Its IUPAC name is 7-[[5-(2,6-diethylanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-2-methyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-[[5-(2,6-diethylanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-2-methyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 55737500 |
| Molecular Formula | C19H20N6OS3 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 7-[[5-(2,6-diethylanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-2-methyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CCc1cccc(CC)c1Nc1nnc(SCc2cc(=O)n3nc(C)sc3n2)s1 |
| InChI | InChI=1S/C19H20N6OS3/c1-4-12-7-6-8-13(5-2)16(12)21-17-22-23-19(29-17)27-10-14-9-15(26)25-18(20-14)28-11(3)24-25/h6-9H,4-5,10H2,1-3H3,(H,21,22) |
| InChIKey | LUVQKAWVQKAIEM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |