C15H18N8S2 — CID 9477587
6-[[5-(2-ethyl-6-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 9477587) has the molecular formula C15H18N8S2 and a molecular weight of 374.50 g/mol. Its IUPAC name is 6-[[5-(2-ethyl-6-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[[5-(2-ethyl-6-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 9477587 |
| Molecular Formula | C15H18N8S2 |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 6-[[5-(2-ethyl-6-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CCc1cccc(C)c1Nc1nnc(SCc2nc(N)nc(N)n2)s1 |
| InChI | InChI=1S/C15H18N8S2/c1-3-9-6-4-5-8(2)11(9)20-14-22-23-15(25-14)24-7-10-18-12(16)21-13(17)19-10/h4-6H,3,7H2,1-2H3,(H,20,22)(H4,16,17,18,19,21) |
| InChIKey | RDOBVUJKPQOVOQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 128.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |