C15H18N8S2 — CID 41479835
2-N,2-N-dimethyl-6-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 41479835) has the molecular formula C15H18N8S2 and a molecular weight of 374.50 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-6-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-dimethyl-6-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 41479835 |
| Molecular Formula | C15H18N8S2 |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 2-N,2-N-dimethyl-6-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1cccc(Nc2nnc(SCc3nc(N)nc(N(C)C)n3)s2)c1 |
| InChI | InChI=1S/C15H18N8S2/c1-9-5-4-6-10(7-9)17-14-21-22-15(25-14)24-8-11-18-12(16)20-13(19-11)23(2)3/h4-7H,8H2,1-3H3,(H,17,21)(H2,16,18,19,20) |
| InChIKey | JMXQSUDUQMBICO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 105.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |