C9H13N7S3 — CID 46670988
2-N,2-N-dimethyl-6-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 46670988) has the molecular formula C9H13N7S3 and a molecular weight of 315.45 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-6-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-dimethyl-6-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 46670988 |
| Molecular Formula | C9H13N7S3 |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 2-N,2-N-dimethyl-6-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CSc1nnc(SCc2nc(N)nc(N(C)C)n2)s1 |
| InChI | InChI=1S/C9H13N7S3/c1-16(2)7-12-5(11-6(10)13-7)4-18-9-15-14-8(17-3)19-9/h4H2,1-3H3,(H2,10,11,12,13) |
| InChIKey | UUJXUAVBKMMJBP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |