C15H17FN8S — CID 17455451
6-[[5-(2-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 17455451) has the molecular formula C15H17FN8S and a molecular weight of 360.42 g/mol. Its IUPAC name is 6-[[5-(2-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[[5-(2-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 17455451 |
| Molecular Formula | C15H17FN8S |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 6-[[5-(2-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)c1nc(N)nc(CSc2nnc(-c3ccccc3F)n2C)n1 |
| InChI | InChI=1S/C15H17FN8S/c1-23(2)14-19-11(18-13(17)20-14)8-25-15-22-21-12(24(15)3)9-6-4-5-7-10(9)16/h4-7H,8H2,1-3H3,(H2,17,18,19,20) |
| InChIKey | OKDSPGLHCJNWBN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |