C20H19ClN8OS — CID 17450512
2-N-(4-chlorophenyl)-6-[[5-(2-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 17450512) has the molecular formula C20H19ClN8OS and a molecular weight of 454.95 g/mol. Its IUPAC name is 2-N-(4-chlorophenyl)-6-[[5-(2-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(4-chlorophenyl)-6-[[5-(2-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 17450512 |
| Molecular Formula | C20H19ClN8OS |
| Molecular Weight | 454.95 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 2-N-(4-chlorophenyl)-6-[[5-(2-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccccc1-c1nnc(SCc2nc(N)nc(Nc3ccc(Cl)cc3)n2)n1C |
| InChI | InChI=1S/C20H19ClN8OS/c1-29-17(14-5-3-4-6-15(14)30-2)27-28-20(29)31-11-16-24-18(22)26-19(25-16)23-13-9-7-12(21)8-10-13/h3-10H,11H2,1-2H3,(H3,22,23,24,25,26) |
| InChIKey | YHUPGWUAGGJJPT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 116.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.95 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |