C21H20Cl2N8S — CID 41479628
6-[[4-(3-chloro-4-methylphenyl)-5-(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 41479628) has the molecular formula C21H20Cl2N8S and a molecular weight of 487.42 g/mol. Its IUPAC name is 6-[[4-(3-chloro-4-methylphenyl)-5-(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[[4-(3-chloro-4-methylphenyl)-5-(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 41479628 |
| Molecular Formula | C21H20Cl2N8S |
| Molecular Weight | 487.42 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | 6-[[4-(3-chloro-4-methylphenyl)-5-(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(-n2c(SCc3nc(N)nc(N(C)C)n3)nnc2-c2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C21H20Cl2N8S/c1-12-4-9-15(10-16(12)23)31-18(13-5-7-14(22)8-6-13)28-29-21(31)32-11-17-25-19(24)27-20(26-17)30(2)3/h4-10H,11H2,1-3H3,(H2,24,25,26,27) |
| InChIKey | WPXNPSGNABKYOK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |