C8H13N9S — CID 41477279
6-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 41477279) has the molecular formula C8H13N9S and a molecular weight of 267.32 g/mol. Its IUPAC name is 6-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 41477279 |
| Molecular Formula | C8H13N9S |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 6-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)c1nc(N)nc(CSc2n[nH]c(N)n2)n1 |
| InChI | InChI=1S/C8H13N9S/c1-17(2)7-12-4(11-5(9)13-7)3-18-8-14-6(10)15-16-8/h3H2,1-2H3,(H2,9,11,12,13)(H3,10,14,15,16) |
| InChIKey | JBFCZTRQPQFHPK-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |