C21H20F3N5O2S2 — CID 27062915
2-[[2-[[5-(2-ethyl-6-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 27062915) has the molecular formula C21H20F3N5O2S2 and a molecular weight of 495.55 g/mol. Its IUPAC name is 2-[[2-[[5-(2-ethyl-6-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-[[5-(2-ethyl-6-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 27062915 |
| Molecular Formula | C21H20F3N5O2S2 |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | 2-[[2-[[5-(2-ethyl-6-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCc1cccc(C)c1Nc1nnc(SCC(=O)NCC(=O)Nc2ccc(F)c(F)c2F)s1 |
| InChI | InChI=1S/C21H20F3N5O2S2/c1-3-12-6-4-5-11(2)19(12)27-20-28-29-21(33-20)32-10-16(31)25-9-15(30)26-14-8-7-13(22)17(23)18(14)24/h4-8H,3,9-10H2,1-2H3,(H,25,31)(H,26,30)(H,27,28) |
| InChIKey | XIXSNIZCFPXVHU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|