C15H18N6O2S3 — CID 20939576
N-[5-[(5-oxo-2-propyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]butanamide (PubChem CID 20939576) has the molecular formula C15H18N6O2S3 and a molecular weight of 410.55 g/mol. Its IUPAC name is N-[5-[(5-oxo-2-propyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]butanamide.
| Compound Name | N-[5-[(5-oxo-2-propyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 20939576 |
| Molecular Formula | C15H18N6O2S3 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | N-[5-[(5-oxo-2-propyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]butanamide |
| SMILES | CCCC(=O)Nc1nnc(SCc2cc(=O)n3nc(CCC)sc3n2)s1 |
| InChI | InChI=1S/C15H18N6O2S3/c1-3-5-10(22)17-13-18-19-15(26-13)24-8-9-7-12(23)21-14(16-9)25-11(20-21)6-4-2/h7H,3-6,8H2,1-2H3,(H,17,18,22) |
| InChIKey | QOCAKKKCCWQVLF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|