C19H16N6O3S3 — CID 20939451
N-[5-[(2-cyclopropyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-methoxybenzamide (PubChem CID 20939451) has the molecular formula C19H16N6O3S3 and a molecular weight of 472.58 g/mol. Its IUPAC name is N-[5-[(2-cyclopropyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-methoxybenzamide.
| Compound Name | N-[5-[(2-cyclopropyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 20939451 |
| Molecular Formula | C19H16N6O3S3 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | N-[5-[(2-cyclopropyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2nnc(SCc3cc(=O)n4nc(C5CC5)sc4n3)s2)cc1 |
| InChI | InChI=1S/C19H16N6O3S3/c1-28-13-6-4-10(5-7-13)15(27)21-17-22-23-19(31-17)29-9-12-8-14(26)25-18(20-12)30-16(24-25)11-2-3-11/h4-8,11H,2-3,9H2,1H3,(H,21,22,27) |
| InChIKey | UQBCZPIHUZAORU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|