C17H16N6O2S4 — CID 20939425
N-[5-[(2-butyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]thiophene-2-carboxamide (PubChem CID 20939425) has the molecular formula C17H16N6O2S4 and a molecular weight of 464.62 g/mol. Its IUPAC name is N-[5-[(2-butyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[5-[(2-butyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 20939425 |
| Molecular Formula | C17H16N6O2S4 |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.02 |
| IUPAC Name | N-[5-[(2-butyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]thiophene-2-carboxamide |
| SMILES | CCCCc1nn2c(=O)cc(CSc3nnc(NC(=O)c4cccs4)s3)nc2s1 |
| InChI | InChI=1S/C17H16N6O2S4/c1-2-3-6-12-22-23-13(24)8-10(18-16(23)28-12)9-27-17-21-20-15(29-17)19-14(25)11-5-4-7-26-11/h4-5,7-8H,2-3,6,9H2,1H3,(H,19,20,25) |
| InChIKey | SSANROSYIJNMNH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|