C20H17N5O2S2 — CID 50802240
N-[5-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-phenylpropanamide (PubChem CID 50802240) has the molecular formula C20H17N5O2S2 and a molecular weight of 423.52 g/mol. Its IUPAC name is N-[5-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-phenylpropanamide.
| Compound Name | N-[5-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 50802240 |
| Molecular Formula | C20H17N5O2S2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | N-[5-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)Nc1nnc(SCc2cc(=O)n3ccccc3n2)s1 |
| InChI | InChI=1S/C20H17N5O2S2/c26-17(10-9-14-6-2-1-3-7-14)22-19-23-24-20(29-19)28-13-15-12-18(27)25-11-5-4-8-16(25)21-15/h1-8,11-12H,9-10,13H2,(H,22,23,26) |
| InChIKey | SVHXOKAMTYFMQG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|