C19H16F3N3OS2 — CID 42805734
3-phenyl-N-[5-[[2-(trifluoromethyl)phenyl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 42805734) has the molecular formula C19H16F3N3OS2 and a molecular weight of 423.49 g/mol. Its IUPAC name is 3-phenyl-N-[5-[[2-(trifluoromethyl)phenyl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | 3-phenyl-N-[5-[[2-(trifluoromethyl)phenyl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 42805734 |
| Molecular Formula | C19H16F3N3OS2 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | 3-phenyl-N-[5-[[2-(trifluoromethyl)phenyl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | O=C(CCc1ccccc1)Nc1nnc(SCc2ccccc2C(F)(F)F)s1 |
| InChI | InChI=1S/C19H16F3N3OS2/c20-19(21,22)15-9-5-4-8-14(15)12-27-18-25-24-17(28-18)23-16(26)11-10-13-6-2-1-3-7-13/h1-9H,10-12H2,(H,23,24,26) |
| InChIKey | VPKKXBYSLPBKQP-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|