C21H18N4O2S2 — CID 22580272
N-[5-[(4-oxo-1H-quinolin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-phenylpropanamide (PubChem CID 22580272) has the molecular formula C21H18N4O2S2 and a molecular weight of 422.54 g/mol. Its IUPAC name is N-[5-[(4-oxo-1H-quinolin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-phenylpropanamide.
| Compound Name | N-[5-[(4-oxo-1H-quinolin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 22580272 |
| Molecular Formula | C21H18N4O2S2 |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | N-[5-[(4-oxo-1H-quinolin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)Nc1nnc(SCc2cc(=O)c3ccccc3[nH]2)s1 |
| InChI | InChI=1S/C21H18N4O2S2/c26-18-12-15(22-17-9-5-4-8-16(17)18)13-28-21-25-24-20(29-21)23-19(27)11-10-14-6-2-1-3-7-14/h1-9,12H,10-11,13H2,(H,22,26)(H,23,24,27) |
| InChIKey | OMJHAIFBHVRGGU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|