C19H13F3N6O2S2 — CID 50802373
1-[5-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 50802373) has the molecular formula C19H13F3N6O2S2 and a molecular weight of 478.48 g/mol. Its IUPAC name is 1-[5-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[5-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 50802373 |
| Molecular Formula | C19H13F3N6O2S2 |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | 1-[5-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1nnc(SCc2cc(=O)n3ccccc3n2)s1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H13F3N6O2S2/c20-19(21,22)12-5-1-2-6-13(12)24-16(30)25-17-26-27-18(32-17)31-10-11-9-15(29)28-8-4-3-7-14(28)23-11/h1-9H,10H2,(H2,24,25,26,30) |
| InChIKey | VJPBOMZYMNLTLO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|