C20H18N6O2S2 — CID 50802409
1-[5-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(3-methylphenyl)urea (PubChem CID 50802409) has the molecular formula C20H18N6O2S2 and a molecular weight of 438.54 g/mol. Its IUPAC name is 1-[5-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[5-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 50802409 |
| Molecular Formula | C20H18N6O2S2 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 1-[5-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)Nc2nnc(SCc3cc(=O)n4cc(C)ccc4n3)s2)c1 |
| InChI | InChI=1S/C20H18N6O2S2/c1-12-4-3-5-14(8-12)22-18(28)23-19-24-25-20(30-19)29-11-15-9-17(27)26-10-13(2)6-7-16(26)21-15/h3-10H,11H2,1-2H3,(H2,22,23,24,28) |
| InChIKey | NYUIBAKHVXVRGX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|