C21H18N6O4S2 — CID 50802294
methyl 4-[[5-[(9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]carbamoylamino]benzoate (PubChem CID 50802294) has the molecular formula C21H18N6O4S2 and a molecular weight of 482.55 g/mol. Its IUPAC name is methyl 4-[[5-[(9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]carbamoylamino]benzoate.
| Compound Name | methyl 4-[[5-[(9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 50802294 |
| Molecular Formula | C21H18N6O4S2 |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | methyl 4-[[5-[(9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]carbamoylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)Nc2nnc(SCc3cc(=O)n4cccc(C)c4n3)s2)cc1 |
| InChI | InChI=1S/C21H18N6O4S2/c1-12-4-3-9-27-16(28)10-15(22-17(12)27)11-32-21-26-25-20(33-21)24-19(30)23-14-7-5-13(6-8-14)18(29)31-2/h3-10H,11H2,1-2H3,(H2,23,24,25,30) |
| InChIKey | OACMJWDESUILSV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 127.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|