C21H20N6O2S2 — CID 56727352
1-(2,5-dimethylphenyl)-3-[5-[(8-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]urea (PubChem CID 56727352) has the molecular formula C21H20N6O2S2 and a molecular weight of 452.57 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-[5-[(8-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-[5-[(8-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 56727352 |
| Molecular Formula | C21H20N6O2S2 |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-[5-[(8-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]urea |
| SMILES | Cc1ccc(C)c(NC(=O)Nc2nnc(SCc3cc(=O)n4ccc(C)cc4n3)s2)c1 |
| InChI | InChI=1S/C21H20N6O2S2/c1-12-4-5-14(3)16(8-12)23-19(29)24-20-25-26-21(31-20)30-11-15-10-18(28)27-7-6-13(2)9-17(27)22-15/h4-10H,11H2,1-3H3,(H2,23,24,25,29) |
| InChIKey | NKTAUPGVORFJIR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|