C20H17FN6O2S2 — CID 50802424
1-(3-fluoro-4-methylphenyl)-3-[5-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]urea (PubChem CID 50802424) has the molecular formula C20H17FN6O2S2 and a molecular weight of 456.53 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylphenyl)-3-[5-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1-(3-fluoro-4-methylphenyl)-3-[5-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 50802424 |
| Molecular Formula | C20H17FN6O2S2 |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 1-(3-fluoro-4-methylphenyl)-3-[5-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]urea |
| SMILES | Cc1ccc2nc(CSc3nnc(NC(=O)Nc4ccc(C)c(F)c4)s3)cc(=O)n2c1 |
| InChI | InChI=1S/C20H17FN6O2S2/c1-11-3-6-16-22-14(8-17(28)27(16)9-11)10-30-20-26-25-19(31-20)24-18(29)23-13-5-4-12(2)15(21)7-13/h3-9H,10H2,1-2H3,(H2,23,24,25,29) |
| InChIKey | AJCCCWSQSFMPCB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|