C20H17N5O3S2 — CID 50802218
2-methoxy-N-[5-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 50802218) has the molecular formula C20H17N5O3S2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 2-methoxy-N-[5-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2-methoxy-N-[5-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 50802218 |
| Molecular Formula | C20H17N5O3S2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 2-methoxy-N-[5-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | COc1ccccc1C(=O)Nc1nnc(SCc2cc(=O)n3cc(C)ccc3n2)s1 |
| InChI | InChI=1S/C20H17N5O3S2/c1-12-7-8-16-21-13(9-17(26)25(16)10-12)11-29-20-24-23-19(30-20)22-18(27)14-5-3-4-6-15(14)28-2/h3-10H,11H2,1-2H3,(H,22,23,27) |
| InChIKey | AMSCCRPSDIQMMJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|