C15H21N3O2S2 — CID 143854804
molecular hydrogen;N-[5-[2-oxo-2-(1-tricyclo[3.3.1.03,7]nonanyl)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 143854804) has the molecular formula C15H21N3O2S2 and a molecular weight of 339.49 g/mol. Its IUPAC name is molecular hydrogen;N-[5-[2-oxo-2-(1-tricyclo[3.3.1.03,7]nonanyl)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | molecular hydrogen;N-[5-[2-oxo-2-(1-tricyclo[3.3.1.03,7]nonanyl)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 143854804 |
| Molecular Formula | C15H21N3O2S2 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | molecular hydrogen;N-[5-[2-oxo-2-(1-tricyclo[3.3.1.03,7]nonanyl)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nnc(SCC(=O)C23CC4CC(C2)C(C4)C3)s1.[H][H] |
| InChI | InChI=1S/C15H19N3O2S2.H2/c1-8(19)16-13-17-18-14(22-13)21-7-12(20)15-4-9-2-10(5-15)11(3-9)6-15;/h9-11H,2-7H2,1H3,(H,16,17,19);1H |
| InChIKey | FXRXNBUYLDPAIW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|