C16H22N4O2S2 — CID 110656679
N-[5-[2-(1-tert-butyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 110656679) has the molecular formula C16H22N4O2S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-[5-[2-(1-tert-butyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[2-(1-tert-butyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 110656679 |
| Molecular Formula | C16H22N4O2S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-[5-[2-(1-tert-butyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nnc(SCC(=O)c2cc(C)n(C(C)(C)C)c2C)s1 |
| InChI | InChI=1S/C16H22N4O2S2/c1-9-7-12(10(2)20(9)16(4,5)6)13(22)8-23-15-19-18-14(24-15)17-11(3)21/h7H,8H2,1-6H3,(H,17,18,21) |
| InChIKey | XMAVJGWQEHNFQJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|